C16H21Cl2N3O3S — CID 8530020
N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(3-chlorophenyl)piperazin-1-yl]acetamide (PubChem CID 8530020) has the molecular formula C16H21Cl2N3O3S and a molecular weight of 406.34 g/mol. Its IUPAC name is N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(3-chlorophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(3-chlorophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8530020 |
| Molecular Formula | C16H21Cl2N3O3S |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(3-chlorophenyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2cccc(Cl)c2)CC1)N[C@@H]1CS(=O)(=O)C[C@@H]1Cl |
| InChI | InChI=1S/C16H21Cl2N3O3S/c17-12-2-1-3-13(8-12)21-6-4-20(5-7-21)9-16(22)19-15-11-25(23,24)10-14(15)18/h1-3,8,14-15H,4-7,9-11H2,(H,19,22)/t14-,15+/m0/s1 |
| InChIKey | HLDVYDJVMKUPFG-LSDHHAIUSA-N |
| XLogP | 0.98 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|