C12H12Cl3NO3S2 — CID 8621441
N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-(2,6-dichlorophenyl)sulfanylacetamide (PubChem CID 8621441) has the molecular formula C12H12Cl3NO3S2 and a molecular weight of 388.73 g/mol. Its IUPAC name is N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-(2,6-dichlorophenyl)sulfanylacetamide.
| Compound Name | N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-(2,6-dichlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 8621441 |
| Molecular Formula | C12H12Cl3NO3S2 |
| Molecular Weight | 388.73 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-(2,6-dichlorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1c(Cl)cccc1Cl)N[C@@H]1CS(=O)(=O)C[C@@H]1Cl |
| InChI | InChI=1S/C12H12Cl3NO3S2/c13-7-2-1-3-8(14)12(7)20-4-11(17)16-10-6-21(18,19)5-9(10)15/h1-3,9-10H,4-6H2,(H,16,17)/t9-,10+/m0/s1 |
| InChIKey | YDNYGNYIQGFZNG-VHSXEESVSA-N |
| XLogP | 2.61 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.73 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|