C11H15ClN4O3S2 — CID 78909890
2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(4-chloro-1,1-dioxothiolan-3-yl)acetamide (PubChem CID 78909890) has the molecular formula C11H15ClN4O3S2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(4-chloro-1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(4-chloro-1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 78909890 |
| Molecular Formula | C11H15ClN4O3S2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(4-chloro-1,1-dioxothiolan-3-yl)acetamide |
| SMILES | Cc1cc(N)nc(SCC(=O)NC2CS(=O)(=O)CC2Cl)n1 |
| InChI | InChI=1S/C11H15ClN4O3S2/c1-6-2-9(13)16-11(14-6)20-3-10(17)15-8-5-21(18,19)4-7(8)12/h2,7-8H,3-5H2,1H3,(H,15,17)(H2,13,14,16) |
| InChIKey | YLZBVLOHBCKSBO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|