C14H18ClNO3S2 — CID 8786852
N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-(2,4-dimethylphenyl)sulfanylacetamide (PubChem CID 8786852) has the molecular formula C14H18ClNO3S2 and a molecular weight of 347.89 g/mol. Its IUPAC name is N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-(2,4-dimethylphenyl)sulfanylacetamide.
| Compound Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-(2,4-dimethylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 8786852 |
| Molecular Formula | C14H18ClNO3S2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-(2,4-dimethylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(SCC(=O)N[C@H]2CS(=O)(=O)C[C@H]2Cl)c(C)c1 |
| InChI | InChI=1S/C14H18ClNO3S2/c1-9-3-4-13(10(2)5-9)20-6-14(17)16-12-8-21(18,19)7-11(12)15/h3-5,11-12H,6-8H2,1-2H3,(H,16,17)/t11-,12+/m1/s1 |
| InChIKey | RZJXJGDGQFCFLK-NEPJUHHUSA-N |
| XLogP | 1.92 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|