C13H17ClN2O3S2 — CID 79128788
2-(2-amino-5-methylphenyl)sulfanyl-N-(4-chloro-1,1-dioxothiolan-3-yl)acetamide (PubChem CID 79128788) has the molecular formula C13H17ClN2O3S2 and a molecular weight of 348.88 g/mol. Its IUPAC name is 2-(2-amino-5-methylphenyl)sulfanyl-N-(4-chloro-1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(2-amino-5-methylphenyl)sulfanyl-N-(4-chloro-1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 79128788 |
| Molecular Formula | C13H17ClN2O3S2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-(2-amino-5-methylphenyl)sulfanyl-N-(4-chloro-1,1-dioxothiolan-3-yl)acetamide |
| SMILES | Cc1ccc(N)c(SCC(=O)NC2CS(=O)(=O)CC2Cl)c1 |
| InChI | InChI=1S/C13H17ClN2O3S2/c1-8-2-3-10(15)12(4-8)20-5-13(17)16-11-7-21(18,19)6-9(11)14/h2-4,9,11H,5-7,15H2,1H3,(H,16,17) |
| InChIKey | RHKRNTQWKDIKGO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|