C17H24ClN3O3S — CID 8725790
N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(2-methylphenyl)piperazin-1-yl]acetamide (PubChem CID 8725790) has the molecular formula C17H24ClN3O3S and a molecular weight of 385.92 g/mol. Its IUPAC name is N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(2-methylphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(2-methylphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8725790 |
| Molecular Formula | C17H24ClN3O3S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(2-methylphenyl)piperazin-1-yl]acetamide |
| SMILES | Cc1ccccc1N1CCN(CC(=O)N[C@H]2CS(=O)(=O)C[C@H]2Cl)CC1 |
| InChI | InChI=1S/C17H24ClN3O3S/c1-13-4-2-3-5-16(13)21-8-6-20(7-9-21)10-17(22)19-15-12-25(23,24)11-14(15)18/h2-5,14-15H,6-12H2,1H3,(H,19,22)/t14-,15+/m1/s1 |
| InChIKey | HEVNDICXNXDVSE-CABCVRRESA-N |
| XLogP | 0.64 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|