C18H24ClN3O4S — CID 8591601
2-[4-(4-acetylphenyl)piperazin-1-yl]-N-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 8591601) has the molecular formula C18H24ClN3O4S and a molecular weight of 413.93 g/mol. Its IUPAC name is 2-[4-(4-acetylphenyl)piperazin-1-yl]-N-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-[4-(4-acetylphenyl)piperazin-1-yl]-N-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 8591601 |
| Molecular Formula | C18H24ClN3O4S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-[4-(4-acetylphenyl)piperazin-1-yl]-N-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CC(=O)c1ccc(N2CCN(CC(=O)N[C@@H]3CS(=O)(=O)C[C@H]3Cl)CC2)cc1 |
| InChI | InChI=1S/C18H24ClN3O4S/c1-13(23)14-2-4-15(5-3-14)22-8-6-21(7-9-22)10-18(24)20-17-12-27(25,26)11-16(17)19/h2-5,16-17H,6-12H2,1H3,(H,20,24)/t16-,17-/m1/s1 |
| InChIKey | LWEYSCMRHBRCNW-IAGOWNOFSA-N |
| XLogP | 0.53 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|