C16H22ClFN3O3S+ — CID 8704033
N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8704033) has the molecular formula C16H22ClFN3O3S+ and a molecular weight of 390.89 g/mol. Its IUPAC name is N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8704033 |
| Molecular Formula | C16H22ClFN3O3S+ |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccc(F)cc2)CC1)N[C@H]1CS(=O)(=O)C[C@H]1Cl |
| InChI | InChI=1S/C16H21ClFN3O3S/c17-14-10-25(23,24)11-15(14)19-16(22)9-20-5-7-21(8-6-20)13-3-1-12(18)2-4-13/h1-4,14-15H,5-11H2,(H,19,22)/p+1/t14-,15+/m1/s1 |
| InChIKey | JTJPOXODVJWNCW-CABCVRRESA-O |
| XLogP | -0.95 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|