C20H24BrFN3O+ — CID 8704017
N-[(1R)-1-(4-bromophenyl)ethyl]-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8704017) has the molecular formula C20H24BrFN3O+ and a molecular weight of 421.33 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromophenyl)ethyl]-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[(1R)-1-(4-bromophenyl)ethyl]-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8704017 |
| Molecular Formula | C20H24BrFN3O+ |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-[(1R)-1-(4-bromophenyl)ethyl]-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | C[C@@H](NC(=O)C[NH+]1CCN(c2ccc(F)cc2)CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H23BrFN3O/c1-15(16-2-4-17(21)5-3-16)23-20(26)14-24-10-12-25(13-11-24)19-8-6-18(22)7-9-19/h2-9,15H,10-14H2,1H3,(H,23,26)/p+1/t15-/m1/s1 |
| InChIKey | FRNYNSBGAVOOCN-OAHLLOKOSA-O |
| XLogP | 2.17 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |