C22H28FN4O2+ — CID 2478164
2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 2478164) has the molecular formula C22H28FN4O2+ and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2478164 |
| Molecular Formula | C22H28FN4O2+ |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccc(F)cc2)CC1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H27FN4O2/c23-18-1-5-20(6-2-18)26-11-9-25(10-12-26)17-22(28)24-19-3-7-21(8-4-19)27-13-15-29-16-14-27/h1-8H,9-17H2,(H,24,28)/p+1 |
| InChIKey | XKSRPXRKCRZPIY-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|