C18H27N4O3+ — CID 2400582
1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide (PubChem CID 2400582) has the molecular formula C18H27N4O3+ and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 2400582 |
| Molecular Formula | C18H27N4O3+ |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide |
| SMILES | NC(=O)C1CC[NH+](CC(=O)Nc2ccc(N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C18H26N4O3/c19-18(24)14-5-7-21(8-6-14)13-17(23)20-15-1-3-16(4-2-15)22-9-11-25-12-10-22/h1-4,14H,5-13H2,(H2,19,24)(H,20,23)/p+1 |
| InChIKey | XOYQIIFHPPPIIV-UHFFFAOYSA-O |
| XLogP | -0.76 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|