C19H30N3O2+ — CID 8686861
2-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 8686861) has the molecular formula C19H30N3O2+ and a molecular weight of 332.47 g/mol. Its IUPAC name is 2-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 8686861 |
| Molecular Formula | C19H30N3O2+ |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | C[C@H]1C[NH+](CC(=O)Nc2ccc(N3CCCCC3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H29N3O2/c1-15-12-21(13-16(2)24-15)14-19(23)20-17-6-8-18(9-7-17)22-10-4-3-5-11-22/h6-9,15-16H,3-5,10-14H2,1-2H3,(H,20,23)/p+1/t15-,16-/m0/s1 |
| InChIKey | GUKQAFCIGNQRET-HOTGVXAUSA-O |
| XLogP | 1.31 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|