C20H25N2O3+ — CID 8899985
2-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 8899985) has the molecular formula C20H25N2O3+ and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 8899985 |
| Molecular Formula | C20H25N2O3+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | C[C@H]1C[NH+](CC(=O)Nc2ccc(Oc3ccccc3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H24N2O3/c1-15-12-22(13-16(2)24-15)14-20(23)21-17-8-10-19(11-9-17)25-18-6-4-3-5-7-18/h3-11,15-16H,12-14H2,1-2H3,(H,21,23)/p+1/t15-,16-/m0/s1 |
| InChIKey | DXCPNWGAEFOGFG-HOTGVXAUSA-O |
| XLogP | 2.11 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |