C15H20N3O2+ — CID 8899697
N-(3-cyanophenyl)-2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide (PubChem CID 8899697) has the molecular formula C15H20N3O2+ and a molecular weight of 274.34 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide.
| Compound Name | N-(3-cyanophenyl)-2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide |
|---|---|
| PubChem CID | 8899697 |
| Molecular Formula | C15H20N3O2+ |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | N-(3-cyanophenyl)-2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide |
| SMILES | C[C@@H]1C[NH+](CC(=O)Nc2cccc(C#N)c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C15H19N3O2/c1-11-8-18(9-12(2)20-11)10-15(19)17-14-5-3-4-13(6-14)7-16/h3-6,11-12H,8-10H2,1-2H3,(H,17,19)/p+1/t11-,12-/m1/s1 |
| InChIKey | PHTSGKODSARIJU-VXGBXAGGSA-O |
| XLogP | 0.19 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |