C24H29FN2O2 — CID 121319959
N-(4-fluorophenyl)-2-[4-(4-morpholin-4-ylphenyl)cyclohexyl]acetamide (PubChem CID 121319959) has the molecular formula C24H29FN2O2 and a molecular weight of 396.51 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-(4-morpholin-4-ylphenyl)cyclohexyl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-(4-morpholin-4-ylphenyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 121319959 |
| Molecular Formula | C24H29FN2O2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-(4-morpholin-4-ylphenyl)cyclohexyl]acetamide |
| SMILES | O=C(CC1CCC(c2ccc(N3CCOCC3)cc2)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H29FN2O2/c25-21-7-9-22(10-8-21)26-24(28)17-18-1-3-19(4-2-18)20-5-11-23(12-6-20)27-13-15-29-16-14-27/h5-12,18-19H,1-4,13-17H2,(H,26,28) |
| InChIKey | ARRFEKOXSSVVOK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|