C12H22ClN3O3S — CID 63872554
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(3,5-dimethylpiperazin-1-yl)acetamide (PubChem CID 63872554) has the molecular formula C12H22ClN3O3S and a molecular weight of 323.85 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(3,5-dimethylpiperazin-1-yl)acetamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(3,5-dimethylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 63872554 |
| Molecular Formula | C12H22ClN3O3S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(3,5-dimethylpiperazin-1-yl)acetamide |
| SMILES | CC1CN(CC(=O)NC2CS(=O)(=O)CC2Cl)CC(C)N1 |
| InChI | InChI=1S/C12H22ClN3O3S/c1-8-3-16(4-9(2)14-8)5-12(17)15-11-7-20(18,19)6-10(11)13/h8-11,14H,3-7H2,1-2H3,(H,15,17) |
| InChIKey | ZAQMSTDHVZZSEI-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|