C11H19ClN2O4S — CID 66260988
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]acetamide (PubChem CID 66260988) has the molecular formula C11H19ClN2O4S and a molecular weight of 310.80 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-2-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 66260988 |
| Molecular Formula | C11H19ClN2O4S |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC[C@@H]1CO)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C11H19ClN2O4S/c12-9-6-19(17,18)7-10(9)13-11(16)4-14-3-1-2-8(14)5-15/h8-10,15H,1-7H2,(H,13,16)/t8-,9?,10?/m1/s1 |
| InChIKey | KJLBOGGWAPNSJK-XNWIYYODSA-N |
| XLogP | -1.04 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|