C13H24ClN3O3S — CID 63250066
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-[2-(methylaminomethyl)piperidin-1-yl]acetamide (PubChem CID 63250066) has the molecular formula C13H24ClN3O3S and a molecular weight of 337.87 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-2-[2-(methylaminomethyl)piperidin-1-yl]acetamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-[2-(methylaminomethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 63250066 |
| Molecular Formula | C13H24ClN3O3S |
| Molecular Weight | 337.87 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-[2-(methylaminomethyl)piperidin-1-yl]acetamide |
| SMILES | CNCC1CCCCN1CC(=O)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C13H24ClN3O3S/c1-15-6-10-4-2-3-5-17(10)7-13(18)16-12-9-21(19,20)8-11(12)14/h10-12,15H,2-9H2,1H3,(H,16,18) |
| InChIKey | ZVLFETMRQJMMAG-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.87 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|