C10H21N3O — CID 63873526
2-(3,5-dimethylpiperazin-1-yl)-N-ethylacetamide (PubChem CID 63873526) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-(3,5-dimethylpiperazin-1-yl)-N-ethylacetamide.
| Compound Name | 2-(3,5-dimethylpiperazin-1-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 63873526 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 2-(3,5-dimethylpiperazin-1-yl)-N-ethylacetamide |
| SMILES | CCNC(=O)CN1CC(C)NC(C)C1 |
| InChI | InChI=1S/C10H21N3O/c1-4-11-10(14)7-13-5-8(2)12-9(3)6-13/h8-9,12H,4-7H2,1-3H3,(H,11,14) |
| InChIKey | ZFATWJQWCGPZBH-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |