C11H18N2O5 — CID 112568166
1-[2-(ethylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid (PubChem CID 112568166) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is 1-[2-(ethylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-[2-(ethylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 112568166 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-[2-(ethylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid |
| SMILES | CCNC(=O)CN1CCC(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C11H18N2O5/c1-2-12-9(14)6-13-4-3-7(10(15)16)8(5-13)11(17)18/h7-8H,2-6H2,1H3,(H,12,14)(H,15,16)(H,17,18) |
| InChIKey | LHDYPZJRFGNREF-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |