About 1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid
1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid (PubChem CID 115918685) has the molecular formula C13H22N2O5
and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid |
| PubChem CID | 115918685 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid |
| SMILES | CC(C)(C)NC(=O)CN1CCC(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C13H22N2O5/c1-13(2,3)14-10(16)7-15-5-4-8(11(17)18)9(6-15)12(19)20/h8-9H,4-7H2,1-3H3,(H,14,16)(H,17,18)(H,19,20) |
| InChIKey | QNEHNLZYVLQSNG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid?
The IUPAC name of 1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid (CID 115918685) is 1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid.
What is the SMILES notation for 1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid?
The canonical SMILES for 1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid is CC(C)(C)NC(=O)CN1CCC(C(=O)O)C(C(=O)O)C1.
What is the InChIKey of 1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid?
The InChIKey is QNEHNLZYVLQSNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O5/c1-13(2,3)14-10(16)7-15-5-4-8(11(17)18)9(6-15)12(19)20/h8-9H,4-7H2,1-3H3,(H,14,16)(H,17,18)(H,19,20).
What are the key properties of 1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid?
1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid has a molecular weight of 286.33 g/mol, XLogP of 0.01, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(tert-butylamino)-2-oxoethyl]piperidine-3,4-dicarboxylic acid is sourced from PubChem (CID 115918685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).