C10H17ClN2O5S2 — CID 60929144
2-amino-4-[2-[(4-chloro-1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]sulfanylbutanoic acid (PubChem CID 60929144) has the molecular formula C10H17ClN2O5S2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 2-amino-4-[2-[(4-chloro-1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[2-[(4-chloro-1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 60929144 |
| Molecular Formula | C10H17ClN2O5S2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-amino-4-[2-[(4-chloro-1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCC(=O)NC1CS(=O)(=O)CC1Cl)C(=O)O |
| InChI | InChI=1S/C10H17ClN2O5S2/c11-6-4-20(17,18)5-8(6)13-9(14)3-19-2-1-7(12)10(15)16/h6-8H,1-5,12H2,(H,13,14)(H,15,16) |
| InChIKey | VMIPYUDHKBNTLT-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|