C9H16ClNO4S2 — CID 124931682
(2S)-2-[[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 124931682) has the molecular formula C9H16ClNO4S2 and a molecular weight of 301.82 g/mol. Its IUPAC name is (2S)-2-[[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 124931682 |
| Molecular Formula | C9H16ClNO4S2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | (2S)-2-[[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](N[C@H]1CS(=O)(=O)C[C@H]1Cl)C(=O)O |
| InChI | InChI=1S/C9H16ClNO4S2/c1-16-3-2-7(9(12)13)11-8-5-17(14,15)4-6(8)10/h6-8,11H,2-5H2,1H3,(H,12,13)/t6-,7+,8+/m1/s1 |
| InChIKey | BUCYEWHWSVJTTI-CSMHCCOUSA-N |
| XLogP | 0.19 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|