C7H11Cl2NO2S — CID 79173052
2-amino-4-(2,3-dichloroprop-2-enylsulfanyl)butanoic acid (PubChem CID 79173052) has the molecular formula C7H11Cl2NO2S and a molecular weight of 244.14 g/mol. Its IUPAC name is 2-amino-4-(2,3-dichloroprop-2-enylsulfanyl)butanoic acid.
| Compound Name | 2-amino-4-(2,3-dichloroprop-2-enylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 79173052 |
| Molecular Formula | C7H11Cl2NO2S |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 2-amino-4-(2,3-dichloroprop-2-enylsulfanyl)butanoic acid |
| SMILES | NC(CCSCC(Cl)=CCl)C(=O)O |
| InChI | InChI=1S/C7H11Cl2NO2S/c8-3-5(9)4-13-2-1-6(10)7(11)12/h3,6H,1-2,4,10H2,(H,11,12) |
| InChIKey | AIODCKVXVZONDK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|