C18H17Cl4N3O — CID 4238150
2-[4-(3-chlorophenyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 4238150) has the molecular formula C18H17Cl4N3O and a molecular weight of 433.17 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4238150 |
| Molecular Formula | C18H17Cl4N3O |
| Molecular Weight | 433.17 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CN1CCN(c2cccc(Cl)c2)CC1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl4N3O/c19-12-2-1-3-13(8-12)25-6-4-24(5-7-25)11-18(26)23-17-10-15(21)14(20)9-16(17)22/h1-3,8-10H,4-7,11H2,(H,23,26) |
| InChIKey | LKHFQQNLRSJFPP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.17 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|