C17H29Cl2N5O — CID 119477889
N-(4-aminocyclohexyl)-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide;dihydrochloride (PubChem CID 119477889) has the molecular formula C17H29Cl2N5O and a molecular weight of 390.36 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide;dihydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119477889 |
| Molecular Formula | C17H29Cl2N5O |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.NC1CCC(NC(=O)CN2CCN(c3ccccn3)CC2)CC1 |
| InChI | InChI=1S/C17H27N5O.2ClH/c18-14-4-6-15(7-5-14)20-17(23)13-21-9-11-22(12-10-21)16-3-1-2-8-19-16;;/h1-3,8,14-15H,4-7,9-13,18H2,(H,20,23);2*1H |
| InChIKey | IWVSOEOATZXACX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |