C17H23Cl2N5O — CID 120643499
2-(5-amino-2-pyridinyl)-N-(1-pyridin-2-ylpiperidin-4-yl)acetamide;dihydrochloride (PubChem CID 120643499) has the molecular formula C17H23Cl2N5O and a molecular weight of 384.31 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-N-(1-pyridin-2-ylpiperidin-4-yl)acetamide;dihydrochloride.
| Compound Name | 2-(5-amino-2-pyridinyl)-N-(1-pyridin-2-ylpiperidin-4-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120643499 |
| Molecular Formula | C17H23Cl2N5O |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-N-(1-pyridin-2-ylpiperidin-4-yl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CC(=O)NC2CCN(c3ccccn3)CC2)nc1 |
| InChI | InChI=1S/C17H21N5O.2ClH/c18-13-4-5-15(20-12-13)11-17(23)21-14-6-9-22(10-7-14)16-3-1-2-8-19-16;;/h1-5,8,12,14H,6-7,9-11,18H2,(H,21,23);2*1H |
| InChIKey | UVBNFPAEOYEFOI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |