C18H18N6O2 — CID 9468283
3-phenyl-N'-[2-(5-phenyltetrazol-2-yl)acetyl]propanehydrazide (PubChem CID 9468283) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 3-phenyl-N'-[2-(5-phenyltetrazol-2-yl)acetyl]propanehydrazide.
| Compound Name | 3-phenyl-N'-[2-(5-phenyltetrazol-2-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 9468283 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3-phenyl-N'-[2-(5-phenyltetrazol-2-yl)acetyl]propanehydrazide |
| SMILES | O=C(CCc1ccccc1)NNC(=O)Cn1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H18N6O2/c25-16(12-11-14-7-3-1-4-8-14)19-20-17(26)13-24-22-18(21-23-24)15-9-5-2-6-10-15/h1-10H,11-13H2,(H,19,25)(H,20,26) |
| InChIKey | BGIZFAZPUGJXRN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|