C14H20N8OS — CID 8626187
1-[2-(dimethylamino)ethyl]-3-[[2-(5-phenyltetrazol-2-yl)acetyl]amino]thiourea (PubChem CID 8626187) has the molecular formula C14H20N8OS and a molecular weight of 348.44 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[[2-(5-phenyltetrazol-2-yl)acetyl]amino]thiourea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[[2-(5-phenyltetrazol-2-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8626187 |
| Molecular Formula | C14H20N8OS |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[[2-(5-phenyltetrazol-2-yl)acetyl]amino]thiourea |
| SMILES | CN(C)CCNC(=S)NNC(=O)Cn1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H20N8OS/c1-21(2)9-8-15-14(24)18-16-12(23)10-22-19-13(17-20-22)11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3,(H,16,23)(H2,15,18,24) |
| InChIKey | CCSKRIZPQGVTIY-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|