C18H18N6O3 — CID 8635386
4-(methoxymethyl)-N'-[2-(5-phenyltetrazol-2-yl)acetyl]benzohydrazide (PubChem CID 8635386) has the molecular formula C18H18N6O3 and a molecular weight of 366.38 g/mol. Its IUPAC name is 4-(methoxymethyl)-N'-[2-(5-phenyltetrazol-2-yl)acetyl]benzohydrazide.
| Compound Name | 4-(methoxymethyl)-N'-[2-(5-phenyltetrazol-2-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8635386 |
| Molecular Formula | C18H18N6O3 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-(methoxymethyl)-N'-[2-(5-phenyltetrazol-2-yl)acetyl]benzohydrazide |
| SMILES | COCc1ccc(C(=O)NNC(=O)Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H18N6O3/c1-27-12-13-7-9-15(10-8-13)18(26)21-19-16(25)11-24-22-17(20-23-24)14-5-3-2-4-6-14/h2-10H,11-12H2,1H3,(H,19,25)(H,21,26) |
| InChIKey | QERWAVVDWZZXMN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|