C22H26N6O3 — CID 9468307
4-hexoxy-N'-[2-(5-phenyltetrazol-2-yl)acetyl]benzohydrazide (PubChem CID 9468307) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 4-hexoxy-N'-[2-(5-phenyltetrazol-2-yl)acetyl]benzohydrazide.
| Compound Name | 4-hexoxy-N'-[2-(5-phenyltetrazol-2-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9468307 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 4-hexoxy-N'-[2-(5-phenyltetrazol-2-yl)acetyl]benzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H26N6O3/c1-2-3-4-8-15-31-19-13-11-18(12-14-19)22(30)25-23-20(29)16-28-26-21(24-27-28)17-9-6-5-7-10-17/h5-7,9-14H,2-4,8,15-16H2,1H3,(H,23,29)(H,25,30) |
| InChIKey | XIMPMBSCPHEXOM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|