C17H14N6O4 — CID 4796127
N'-[2-(5-phenyltetrazol-2-yl)acetyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 4796127) has the molecular formula C17H14N6O4 and a molecular weight of 366.34 g/mol. Its IUPAC name is N'-[2-(5-phenyltetrazol-2-yl)acetyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[2-(5-phenyltetrazol-2-yl)acetyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 4796127 |
| Molecular Formula | C17H14N6O4 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N'-[2-(5-phenyltetrazol-2-yl)acetyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14N6O4/c24-15(9-23-21-16(19-22-23)11-4-2-1-3-5-11)18-20-17(25)12-6-7-13-14(8-12)27-10-26-13/h1-8H,9-10H2,(H,18,24)(H,20,25) |
| InChIKey | YDFZNDSQVUDYAE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|