C20H22N6O2S — CID 9274630
N'-[2-(5-phenyltetrazol-2-yl)acetyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide (PubChem CID 9274630) has the molecular formula C20H22N6O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is N'-[2-(5-phenyltetrazol-2-yl)acetyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(5-phenyltetrazol-2-yl)acetyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9274630 |
| Molecular Formula | C20H22N6O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N'-[2-(5-phenyltetrazol-2-yl)acetyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)NNC(=O)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C20H22N6O2S/c27-18(13-26-24-19(22-25-26)14-8-5-3-6-9-14)21-23-20(28)17-12-15-10-4-1-2-7-11-16(15)29-17/h3,5-6,8-9,12H,1-2,4,7,10-11,13H2,(H,21,27)(H,23,28) |
| InChIKey | NLQJOEPJPATCFF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|