C20H18N4O5 — CID 39714352
N'-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanoyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 39714352) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is N'-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanoyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanoyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 39714352 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N'-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanoyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(CCCc1nnc(-c2ccccc2)o1)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H18N4O5/c25-17(21-23-19(26)14-9-10-15-16(11-14)28-12-27-15)7-4-8-18-22-24-20(29-18)13-5-2-1-3-6-13/h1-3,5-6,9-11H,4,7-8,12H2,(H,21,25)(H,23,26) |
| InChIKey | NDEMLDNOEJPADP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|