C19H19N3O5 — CID 39761126
N-[4-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-4-oxobutyl]benzamide (PubChem CID 39761126) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is N-[4-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 39761126 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-[4-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccccc1)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H19N3O5/c23-17(7-4-10-20-18(24)13-5-2-1-3-6-13)21-22-19(25)14-8-9-15-16(11-14)27-12-26-15/h1-3,5-6,8-9,11H,4,7,10,12H2,(H,20,24)(H,21,23)(H,22,25) |
| InChIKey | UHLHGERMUZZPTJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|