C19H19N3O5 — CID 46689775
N-[4-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-4-oxobutan-2-yl]benzamide (PubChem CID 46689775) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is N-[4-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-4-oxobutan-2-yl]benzamide.
| Compound Name | N-[4-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-4-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 46689775 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-[4-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-4-oxobutan-2-yl]benzamide |
| SMILES | CC(CC(=O)NNC(=O)c1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O5/c1-12(20-18(24)13-5-3-2-4-6-13)9-17(23)21-22-19(25)14-7-8-15-16(10-14)27-11-26-15/h2-8,10,12H,9,11H2,1H3,(H,20,24)(H,21,23)(H,22,25) |
| InChIKey | NGOISTPBHUNNCK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|