C15H20N2O6S — CID 47039467
N'-[2-(3-methylbutylsulfonyl)acetyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 47039467) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is N'-[2-(3-methylbutylsulfonyl)acetyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[2-(3-methylbutylsulfonyl)acetyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 47039467 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N'-[2-(3-methylbutylsulfonyl)acetyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | CC(C)CCS(=O)(=O)CC(=O)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H20N2O6S/c1-10(2)5-6-24(20,21)8-14(18)16-17-15(19)11-3-4-12-13(7-11)23-9-22-12/h3-4,7,10H,5-6,8-9H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | KTGPPHSSSSXVLM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|