C11H13ClN2O3S — CID 113290240
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-methylpyridine-3-carboxamide (PubChem CID 113290240) has the molecular formula C11H13ClN2O3S and a molecular weight of 288.76 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-2-methylpyridine-3-carboxamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 113290240 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-methylpyridine-3-carboxamide |
| SMILES | Cc1ncccc1C(=O)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C11H13ClN2O3S/c1-7-8(3-2-4-13-7)11(15)14-10-6-18(16,17)5-9(10)12/h2-4,9-10H,5-6H2,1H3,(H,14,15) |
| InChIKey | WDCHDKVLEKOUSR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|