C17H17ClN2O2 — CID 97333744
N-[(2R,3S)-2-(4-chlorophenyl)oxolan-3-yl]-2-methylpyridine-3-carboxamide (PubChem CID 97333744) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is N-[(2R,3S)-2-(4-chlorophenyl)oxolan-3-yl]-2-methylpyridine-3-carboxamide.
| Compound Name | N-[(2R,3S)-2-(4-chlorophenyl)oxolan-3-yl]-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 97333744 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-[(2R,3S)-2-(4-chlorophenyl)oxolan-3-yl]-2-methylpyridine-3-carboxamide |
| SMILES | Cc1ncccc1C(=O)N[C@H]1CCO[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN2O2/c1-11-14(3-2-9-19-11)17(21)20-15-8-10-22-16(15)12-4-6-13(18)7-5-12/h2-7,9,15-16H,8,10H2,1H3,(H,20,21)/t15-,16+/m0/s1 |
| InChIKey | SMZNJEQOXCQLOD-JKSUJKDBSA-N |
| XLogP | 3.30 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |