C17H21ClN4O2 — CID 97122784
1-[(2S,3R)-2-(4-chlorophenyl)oxolan-3-yl]-3-(2-propan-2-ylpyrazol-3-yl)urea (PubChem CID 97122784) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 1-[(2S,3R)-2-(4-chlorophenyl)oxolan-3-yl]-3-(2-propan-2-ylpyrazol-3-yl)urea.
| Compound Name | 1-[(2S,3R)-2-(4-chlorophenyl)oxolan-3-yl]-3-(2-propan-2-ylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 97122784 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[(2S,3R)-2-(4-chlorophenyl)oxolan-3-yl]-3-(2-propan-2-ylpyrazol-3-yl)urea |
| SMILES | CC(C)n1nccc1NC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN4O2/c1-11(2)22-15(7-9-19-22)21-17(23)20-14-8-10-24-16(14)12-3-5-13(18)6-4-12/h3-7,9,11,14,16H,8,10H2,1-2H3,(H2,20,21,23)/t14-,16+/m1/s1 |
| InChIKey | ORKOWULBKGOCJZ-ZBFHGGJFSA-N |
| XLogP | 3.77 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |