C12H15ClN2O3S — CID 115338894
N-(4-chloro-1,1-dioxothiolan-3-yl)-2,6-dimethylpyridine-3-carboxamide (PubChem CID 115338894) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-2,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 115338894 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NC2CS(=O)(=O)CC2Cl)c(C)n1 |
| InChI | InChI=1S/C12H15ClN2O3S/c1-7-3-4-9(8(2)14-7)12(16)15-11-6-19(17,18)5-10(11)13/h3-4,10-11H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | SMZBIWQAKDTLCY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|