C11H14ClNO3S2 — CID 115338844
N-(4-chloro-1,1-dioxothiolan-3-yl)-3-ethylthiophene-2-carboxamide (PubChem CID 115338844) has the molecular formula C11H14ClNO3S2 and a molecular weight of 307.82 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-3-ethylthiophene-2-carboxamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-3-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 115338844 |
| Molecular Formula | C11H14ClNO3S2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-3-ethylthiophene-2-carboxamide |
| SMILES | CCc1ccsc1C(=O)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C11H14ClNO3S2/c1-2-7-3-4-17-10(7)11(14)13-9-6-18(15,16)5-8(9)12/h3-4,8-9H,2,5-6H2,1H3,(H,13,14) |
| InChIKey | NYRFFCUUBJCINA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|