C13H16ClNO3S — CID 78910767
N-(4-chloro-1,1-dioxothiolan-3-yl)-4-ethylbenzamide (PubChem CID 78910767) has the molecular formula C13H16ClNO3S and a molecular weight of 301.80 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-4-ethylbenzamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-4-ethylbenzamide |
|---|---|
| PubChem CID | 78910767 |
| Molecular Formula | C13H16ClNO3S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)NC2CS(=O)(=O)CC2Cl)cc1 |
| InChI | InChI=1S/C13H16ClNO3S/c1-2-9-3-5-10(6-4-9)13(16)15-12-8-19(17,18)7-11(12)14/h3-6,11-12H,2,7-8H2,1H3,(H,15,16) |
| InChIKey | HFBYGNLGBRSJMG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|