C14H18BrClN2O3S — CID 11929333
2-[(4-bromophenyl)methyl-methylamino]-N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 11929333) has the molecular formula C14H18BrClN2O3S and a molecular weight of 409.73 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-methylamino]-N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-[(4-bromophenyl)methyl-methylamino]-N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 11929333 |
| Molecular Formula | C14H18BrClN2O3S |
| Molecular Weight | 409.73 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-methylamino]-N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CN(CC(=O)N[C@H]1CS(=O)(=O)C[C@@H]1Cl)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H18BrClN2O3S/c1-18(6-10-2-4-11(15)5-3-10)7-14(19)17-13-9-22(20,21)8-12(13)16/h2-5,12-13H,6-9H2,1H3,(H,17,19)/t12-,13-/m0/s1 |
| InChIKey | LSUHPKQTDOEPIE-STQMWFEESA-N |
| XLogP | 1.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.73 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|