C14H19Cl2N2O3S+ — CID 11929346
[2-[[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-[(4-chlorophenyl)methyl]-methylazanium (PubChem CID 11929346) has the molecular formula C14H19Cl2N2O3S+ and a molecular weight of 366.29 g/mol. Its IUPAC name is [2-[[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-[(4-chlorophenyl)methyl]-methylazanium.
| Compound Name | [2-[[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-[(4-chlorophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 11929346 |
| Molecular Formula | C14H19Cl2N2O3S+ |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | [2-[[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-[(4-chlorophenyl)methyl]-methylazanium |
| SMILES | C[NH+](CC(=O)N[C@H]1CS(=O)(=O)C[C@@H]1Cl)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18Cl2N2O3S/c1-18(6-10-2-4-11(15)5-3-10)7-14(19)17-13-9-22(20,21)8-12(13)16/h2-5,12-13H,6-9H2,1H3,(H,17,19)/p+1/t12-,13-/m0/s1 |
| InChIKey | PEULBODEVXGWGN-STQMWFEESA-O |
| XLogP | -0.12 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|