C15H22ClN2O3S2+ — CID 11930205
[2-[[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium (PubChem CID 11930205) has the molecular formula C15H22ClN2O3S2+ and a molecular weight of 377.94 g/mol. Its IUPAC name is [2-[[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium.
| Compound Name | [2-[[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 11930205 |
| Molecular Formula | C15H22ClN2O3S2+ |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [2-[[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium |
| SMILES | CSc1ccc(C[NH+](C)CC(=O)N[C@@H]2CS(=O)(=O)C[C@@H]2Cl)cc1 |
| InChI | InChI=1S/C15H21ClN2O3S2/c1-18(7-11-3-5-12(22-2)6-4-11)8-15(19)17-14-10-23(20,21)9-13(14)16/h3-6,13-14H,7-10H2,1-2H3,(H,17,19)/p+1/t13-,14+/m0/s1 |
| InChIKey | ITWDICMZVYVBRN-UONOGXRCSA-O |
| XLogP | -0.06 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|