C11H14ClNO4S3 — CID 51558961
N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-4-methylsulfanylbenzenesulfonamide (PubChem CID 51558961) has the molecular formula C11H14ClNO4S3 and a molecular weight of 355.89 g/mol. Its IUPAC name is N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-4-methylsulfanylbenzenesulfonamide.
| Compound Name | N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-4-methylsulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 51558961 |
| Molecular Formula | C11H14ClNO4S3 |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-4-methylsulfanylbenzenesulfonamide |
| SMILES | CSc1ccc(S(=O)(=O)N[C@@H]2CS(=O)(=O)C[C@@H]2Cl)cc1 |
| InChI | InChI=1S/C11H14ClNO4S3/c1-18-8-2-4-9(5-3-8)20(16,17)13-11-7-19(14,15)6-10(11)12/h2-5,10-11,13H,6-7H2,1H3/t10-,11+/m0/s1 |
| InChIKey | CGMGERZWPNAINM-WDEREUQCSA-N |
| XLogP | 1.09 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|