C10H19ClN2O4S2 — CID 113290294
N-(4-chloro-1,1-dioxothiolan-3-yl)azepane-1-sulfonamide (PubChem CID 113290294) has the molecular formula C10H19ClN2O4S2 and a molecular weight of 330.86 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)azepane-1-sulfonamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)azepane-1-sulfonamide |
|---|---|
| PubChem CID | 113290294 |
| Molecular Formula | C10H19ClN2O4S2 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)azepane-1-sulfonamide |
| SMILES | O=S1(=O)CC(Cl)C(NS(=O)(=O)N2CCCCCC2)C1 |
| InChI | InChI=1S/C10H19ClN2O4S2/c11-9-7-18(14,15)8-10(9)12-19(16,17)13-5-3-1-2-4-6-13/h9-10,12H,1-8H2 |
| InChIKey | HAEJPOWZYOABPG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|