C9H17ClN2O4S2 — CID 113290309
N-(4-chloro-1,1-dioxothiolan-3-yl)piperidine-1-sulfonamide (PubChem CID 113290309) has the molecular formula C9H17ClN2O4S2 and a molecular weight of 316.83 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)piperidine-1-sulfonamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 113290309 |
| Molecular Formula | C9H17ClN2O4S2 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)piperidine-1-sulfonamide |
| SMILES | O=S1(=O)CC(Cl)C(NS(=O)(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C9H17ClN2O4S2/c10-8-6-17(13,14)7-9(8)11-18(15,16)12-4-2-1-3-5-12/h8-9,11H,1-7H2 |
| InChIKey | IGYNYHXHBSRIHV-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|