C7H14ClNO4S2 — CID 115339009
N-(4-chloro-1,1-dioxothiolan-3-yl)propane-2-sulfonamide (PubChem CID 115339009) has the molecular formula C7H14ClNO4S2 and a molecular weight of 275.78 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)propane-2-sulfonamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 115339009 |
| Molecular Formula | C7H14ClNO4S2 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C7H14ClNO4S2/c1-5(2)15(12,13)9-7-4-14(10,11)3-6(7)8/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | YEPQHVMJBRCNTQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|